buy pharma api Albendazole,wholesale Albendazole API Intermediates Cas 54965-21-8
Category: API
CAS NO: 54965-21-8
EC NO: 259-414-7

Molecular Formula: C12H15N3O2S

Molecular Weight: 265.3314
Specification: CPV/USP/EP
InChI: InChI=1/C12H15N3O2S/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16)
Synonyms: * Albendazolum [INN-Latin],
* ((Propylthio)-5 1H-benzimidazolyl-2) carbamate de methyle [French],
* (5-(Propylthio)-1H-benzimidazol-2-yl)carbamic acid methyl ester,
* 1503903, * 220008, * 5-(Propylthio)-2-carbomethoxyaminobenzimidazole,
* AIDS-007895, * AIDS007895, * Albendazol [INN-Spanish],
* Albendazole (JAN/USP), * Albendazole [USAN:BAN:INN:JAN],
* Albenza, * Albenza (TN), * Bilutac, * C01779,
* Carbamic acid, [5- (propylthio)-1H-benzimidazol-2-yl]-, methyl ester,
* Carbamic acid, [5-(propylthio)-1H-benzimidazol-2-yl]-, methyl ester,
* CHEMBANK1308, * DRG-0277, * EINECS 259-414-7, * Eskazole,
* Methyl 5-(propylsulfanyl)-1H-benzimidazol-2-ylcarbamate,
* Methyl 5-(propylthio)-2-benzimidazolecarbamate, * MLS000069722,
* NSC 220008, * NSC220008,
* O-Methyl N-(5-(propylthio)-2-benzimidazolyl)carbamate,
* Proftril, * SK&F 62979, * SKandF 62979, * SKF 62979, * SKF-62979,
* SMR000036735, * Valbazen, * Zental, * Zentel,
* ZINC01821118, * ZINC01821119,
* [5-(Propythio)-1H-benzimidazol-2-yl]carbamic acid methyl ester.
Pharmacodynamic Properties:
Albendazole is a broad-spectrum anthelmintic for humans and animals. It works by interfering with proteins in either the worm抯 intestine or absorptive cells. This leads to the worm not being able to absorb sugar (glucose), which are essential for its survival. Therefore the energy stores of the worm are depleted, and this leads to its eventual death within several days.
It is used to treat Hydatid disease (echinococcosis) and infection of the nervous system caused by pork tapeworms (neurocysticercosis), also for Hookworm, Ascariasis, Whipworm and Strongyloidiasis.
Storage: Keep container tightly closed in a cool, well-ventilated area.
MSDS: Provide as per request after the order or contract is signed.
Molecular Structure:
Hi-Tech Business is one of the leading albendazole,wholesale albendazole api intermediates cas 54965-21-8 manufacturers and suppliers. Our products for sale will bring you many benefits without doing any side effect. Welcome to buy or wholesale the product upon right dosage for healthy uses from us, and enjoy our reasonable price.buy pharma api
website:http://www.hi-techbiz.com/api-in-pharma/